|
|
Summary
longprop
| IUPAC name | fluoroform | | | | Synonyms | 75-46-7, InChI=1S/CHF3/c2-1(3)4/h1H, trifluoromethane, trifluoromethane, trifluoromethan | | CAS number | 75-46-7 | | ChemSpider ID | 21106179 | | PubChem ID | 6373 | | Molecular weight | 70.0138 Da | | Formula | CHF3 | | Multiplicity | 1 | | Point group | C3v | | Symmetry number | 3 | | Rotatable bonds | NA | | StdInChi | InChI=1S/CHF3/c2-1(3)4/h1H |
Liquid properties
| Property | Unit | T (K) | Experiment | GAFF-ESP-2012 | OPLS | CGenFF | COSMO-RS | kowwin | GAFF-ESP | XlogP3 |
|---|
| log kOW | | 298.15 | 0.641 | | | | | | | 1.502 | | | | 0.643 | | | | | | | | Flexible models Hydrogen constrained All bonds constrained.
Gas properties
| Property | Unit | T (K) | Experiment | G2 | G3 | G4 | CBS-QB3 | W1BD | W1U | B3LYP/aug-cc-pVTZ | BS | CGenFF | GAFF-BCC-2018 | GAFF-ESP-2018 | AXpp | AXpg | AXps |
|---|
| ZPE | kJ/mol | 298.15 | | | | 66.74 | | | | | | | | | | | | | αaniso | ų | 298.15 | | | | | | | | | | | | | 5 | 5 | 5 | | αxx | ų | 298.15 | | | | | | | | 2.884 | | | | | 2.705 | 2.705 | 2.705 | | αyy | ų | 298.15 | | | | | | | | 2.884 | | | | | 2.705 | 2.705 | 2.705 | | αzz | ų | 298.15 | | | | | | | | 2.674 | | | | | 2.705 | 2.705 | 2.705 | | μxx | D | 298.15 | | | | | | | | 4 | | | | | 5 | 5 | 5 | | μyy | D | 298.15 | | | | | | | | 4 | | | | | 5 | 5 | 5 | | μzz | D | 298.15 | | | | | | | | 1.644 | | | | | 1.695 | 1.685 | 1.685 | | θxx | Buckingham | 298.15 | | | | | | | | -1.234 | | | | | -1.585 | -1.575 | -1.575 | | θyy | Buckingham | 298.15 | | | | | | | | -1.234 | | | | | -1.585 | -1.575 | -1.575 | | θzz | Buckingham | 298.15 | | | | | | | | 2.454 | | | | | 3.155 | 3.145 | 3.145 |
References
- C. L. Yaws Yaws' Handbook of Properties for Environmental and Green Engineering, William Andrew Inc.: Beaumont, Texas (2008).
- T. Cheng and Y. Zhao and X. Li and F. Lin and Y. Xu and X. Zhang and Y. Li and R. Wang and L. Lai Computation of octanol- water partition coefficients by guiding an additive model with knowledge., J. Chem. Inf. Model. 47, 2140-2148 (2007).
- C. L. Yaws Yaws' Handbook of Properties for Aqueous Systems, William Andrew Inc.: Beaumont, Texas (2012).
- Mohammad M. Ghahremanpour and Paul J. van Maaren and David van der Spoel The Alexandria Library: A Quantum-Chemical Database of Molecular Properties for Force Field Development, Sci. Data 5, 180062 (2018). DOI
- Mohammad Mehdi Ghahremanpour and Paul J. van Maaren and Carl Caleman and Geoffrey R. Hutchison and David van der Spoel Polarizable Drude Model with s-type Gaussian or Slater Charge Density for General Molecular Mechanics Force Fields, J. Chem. Theory Comput. 14, 5553-5566 (2018). DOI
|