|
|
Summary
longprop
| IUPAC name | spiro[2.2]pentane | | | | Synonyms | 157-40-4, InChI=1S/C5H8/c1-2-5(1)3-4-5/h1-4H2, spiropentane, spiropentane, spiropentan | | CAS number | 157-40-4 | | ChemSpider ID | 8734 | | PubChem ID | 9088 | | Molecular weight | 68.117 Da | | Formula | C5H8 | | Multiplicity | 1 | | Point group | C1 | | Symmetry number | 1 | | Rotatable bonds | NA | | StdInChi | InChI=1S/C5H8/c1-2-5(1)3-4-5/h1-4H2 |
Liquid properties
| Property | Unit | T (K) | Experiment | GAFF-ESP-2012 | OPLS | CGenFF | COSMO-RS | kowwin | GAFF-ESP | XlogP3 |
|---|
| log kOW | | 298.15 | 2.461 | | | | | | | 2.102 | | | | 2.463 | | | | | | | | Flexible models Hydrogen constrained All bonds constrained.
Gas properties
| Property | Unit | T (K) | Experiment | G2 | G3 | G4 | CBS-QB3 | W1BD | W1U | B3LYP/aug-cc-pVTZ | BS | CGenFF | GAFF-BCC-2018 | GAFF-ESP-2018 | AXpp | AXpg | AXps |
|---|
| E | kJ/mol | 298.15 | | | | 314.364 | | | | | | 302.795 | | | | | | | E-scaled | kJ/mol | 298.15 | | | | | | | | | | 312.515 | | | | | | | ΔHform | kJ/mol | 0 | | 214.34 | 210.44 | 207.14 | 214.94 | | | | | | | | | | | | ΔHform | kJ/mol | 298.15 | 185.4±0.86 | 189.74 | 185.84 | 183.44 | 191.24 | | | | | | | | | | | | | | 195.57 | | | | | | | | | | | | | | | | | | 185.28 | | | | | | | | | | | | | | | | | | 185.1±0.89 | | | | | | | | | | | | | | | | ΔGform | kJ/mol | 298.15 | | 268.24 | 264.34 | 260.54 | 268.34 | | | | | | | | | | | | ΔSform | J/mol K | 298.15 | | -263.34 | -263.34 | -258.84 | -258.74 | | | | | | | | | | | | S0 | J/mol K | 298.15 | 282.767 | 288.114 | 288.114 | 292.634 | 292.724 | | | | | 294.895 | | | | | | | S0-scaled | J/mol K | 298.15 | | | | | | | | | | 292.845 | | | | | | | ZPE | kJ/mol | 298.15 | | | | 301.44 | | | | | | 289.25 | | | | | | | ZPE-scaled | kJ/mol | 298.15 | | | | | | | | | | 299.35 | | | | | | | CV | J/mol K | 298.15 | 79.8±1.610 | 69.94 | 69.94 | 77.94 | 78.24 | | | | | 86.25 | | | | | | | CV-scaled | J/mol K | 298.15 | | | | | | | | | | 82.95 | | | | | | | αaniso | ų | 298.15 | | | | | | | | | | | | | 0.7711 | 0.7711 | 0.7711 | | αxx | ų | 298.15 | | | | | | | | 8.124 | | | | | 8.9911 | 8.9911 | 8.9911 | | αyy | ų | 298.15 | | | | | | | | 8.124 | | | | | 8.2211 | 8.2211 | 8.2211 | | αzz | ų | 298.15 | | | | | | | | 9.944 | | | | | 8.2211 | 8.2211 | 8.2211 | | μxx | D | 298.15 | | | | | | | | 4 | | | | | 11 | 11 | 11 | | μyy | D | 298.15 | | | | | | | | 4 | | | | | 11 | 11 | 11 | | μzz | D | 298.15 | | | | | | | | 4 | | | | | 11 | 11 | 11 | | θxx | Buckingham | 298.15 | | | | | | | | -1.354 | | | | | -2.1611 | -2.1411 | -2.1411 | | θyy | Buckingham | 298.15 | | | | | | | | 0.684 | | | | | 1.0811 | 1.0711 | 1.0711 | | θzz | Buckingham | 298.15 | | | | | | | | 0.684 | | | | | 1.0811 | 1.0711 | 1.0711 |
References
- C. L. Yaws Yaws' Handbook of Properties for Environmental and Green Engineering, William Andrew Inc.: Beaumont, Texas (2008).
- T. Cheng and Y. Zhao and X. Li and F. Lin and Y. Xu and X. Zhang and Y. Li and R. Wang and L. Lai Computation of octanol- water partition coefficients by guiding an additive model with knowledge., J. Chem. Inf. Model. 47, 2140-2148 (2007).
- C. L. Yaws Yaws' Handbook of Properties for Aqueous Systems, William Andrew Inc.: Beaumont, Texas (2012).
- Mohammad M. Ghahremanpour and Paul J. van Maaren and David van der Spoel The Alexandria Library: A Quantum-Chemical Database of Molecular Properties for Force Field Development, Sci. Data 5, 180062 (2018). DOI
- David van der Spoel and Mohammad M. Ghahremanpour and Justin Lemkul Small Molecule Thermochemistry: A Tool For Empirical Force Field Development, J. Phys. Chem. A 122, 8982–8988 (2018). DOI
- Viktor N. Staroverov, Gustavo E. Scuseria, Jianmin Tao and John P. Perdew Comparative assessment of a new nonempirical density functional: Molecules and hydrogen-bonded complexes, J. Chem. Phys. 119, 12129 (2003).
- C. L. Yaws Yaws' Handbook of Thermodynamic Properties for Hydrocarbons and Chemicals, Knovel (2009).
- D. R. Lide CRC Handbook of Chemistry and Physics 90th edition, CRC Press: Cleveland, Ohio (2009).
- Knovel Knovel Critical Tables (2nd Edition), Knovel (2008).
- Mohammad M. Ghahremanpour and Paul J. van Maaren and Jonas C. Ditz and Roland Lindh and David van der Spoel Large-Scale Calculations of Gas Phase Thermochemistry: Enthalpy of Formation, Standard Entropy and Heat Capacity, J. Chem. Phys. 145, 114305 (2016). DOI
- Mohammad Mehdi Ghahremanpour and Paul J. van Maaren and Carl Caleman and Geoffrey R. Hutchison and David van der Spoel Polarizable Drude Model with s-type Gaussian or Slater Charge Density for General Molecular Mechanics Force Fields, J. Chem. Theory Comput. 14, 5553-5566 (2018). DOI
|