|
|
Summary
longprop
| IUPAC name | methyl 2-hydroxypropanoate | | | | Synonyms | 547-64-8, InChI=1S/C4H8O3/c1-3(5)4(6)7-2/h3,5H,1-2H3, methyl lactate, methyl-lactate, methyl-lactat | | CAS number | 547-64-8 | | ChemSpider ID | 13839235 | | PubChem ID | 11040 | | Molecular weight | 104.10452 Da | | Formula | C4H8O3 | | Multiplicity | 1 | | Point group | C1 | | Symmetry number | 1 | | Rotatable bonds | 2 | | StdInChi | InChI=1S/C4H8O3/c1-3(5)4(6)7-2/h3,5H,1-2H3 |
Liquid properties
| Property | Unit | T (K) | Experiment | GAFF-ESP-2012 | OPLS | CGenFF | COSMO-RS | kowwin | GAFF-ESP | XlogP3 |
|---|
| log kOW | | 298.15 | | | | | | | | -0.101 | Flexible models Hydrogen constrained All bonds constrained.
Gas properties
| Property | Unit | T (K) | Experiment | G2 | G3 | G4 | CBS-QB3 | W1BD | W1U | B3LYP/aug-cc-pVTZ | BS | CGenFF | GAFF-BCC-2018 | GAFF-ESP-2018 | AXpp | AXpg | AXps |
|---|
| E | kJ/mol | 298.15 | | | | | | | | | | 333.652 | | | | | | | E-scaled | kJ/mol | 298.15 | | | | | | | | | | 344.102 | | | | | | | S0 | J/mol K | 298.15 | 0.413 | | | | | | | | | 370.142 | | | | | | | S0-scaled | J/mol K | 298.15 | | | | | | | | | | 366.952 | | | | | | | ZPE | kJ/mol | 298.15 | | | | 322.24 | | | | | | 312.02 | | | | | | | ZPE-scaled | kJ/mol | 298.15 | | | | | | | | | | 322.92 | | | | | | | CV | J/mol K | 298.15 | 117.6±2.45 | | | | | | | | | 119.52 | | | | | | | CV-scaled | J/mol K | 298.15 | | | | | | | | | | 116.42 | | | | | | | αaniso | ų | 298.15 | | | | | | | | | | | | | 1.616 | 1.636 | 1.626 | | αxx | ų | 298.15 | | | | | | | | 10.814 | | | | | 10.616 | 10.636 | 10.616 | | αyy | ų | 298.15 | | | | | | | | 9.334 | | | | | 9.236 | 9.226 | 9.226 | | αzz | ų | 298.15 | | | | | | | | 8.064 | | | | | 8.936 | 8.936 | 8.936 | | μxx | D | 298.15 | | | | | | | | -1.284 | | | | | -1.256 | -1.256 | -1.256 | | μyy | D | 298.15 | | | | | | | | -0.844 | | | | | -0.826 | -0.846 | -0.836 | | μzz | D | 298.15 | | | | | | | | 1.764 | | | | | 1.736 | 1.736 | 1.726 | | θxx | Buckingham | 298.15 | | | | | | | | 3.954 | | | | | 5.896 | 5.956 | 5.966 | | θyy | Buckingham | 298.15 | | | | | | | | -2.324 | | | | | -5.906 | -5.866 | -5.876 | | θzz | Buckingham | 298.15 | | | | | | | | 4 | | | | | 0.016 | -0.096 | -0.086 |
References
- T. Cheng and Y. Zhao and X. Li and F. Lin and Y. Xu and X. Zhang and Y. Li and R. Wang and L. Lai Computation of octanol- water partition coefficients by guiding an additive model with knowledge., J. Chem. Inf. Model. 47, 2140-2148 (2007).
- David van der Spoel and Mohammad M. Ghahremanpour and Justin Lemkul Small Molecule Thermochemistry: A Tool For Empirical Force Field Development, J. Phys. Chem. A 122, 8982–8988 (2018). DOI
- R. L. Rowley and W. V. Wilding and J. L. Oscarson and Y. Yang and N. F. Giles Data Compilation of Pure Chemical Properties (Design Institute for Physical Properties, American Institute for Chemical Engineering, New York (2012).
- Mohammad M. Ghahremanpour and Paul J. van Maaren and David van der Spoel The Alexandria Library: A Quantum-Chemical Database of Molecular Properties for Force Field Development, Sci. Data 5, 180062 (2018). DOI
- Mohammad M. Ghahremanpour and Paul J. van Maaren and Jonas C. Ditz and Roland Lindh and David van der Spoel Large-Scale Calculations of Gas Phase Thermochemistry: Enthalpy of Formation, Standard Entropy and Heat Capacity, J. Chem. Phys. 145, 114305 (2016). DOI
- Mohammad Mehdi Ghahremanpour and Paul J. van Maaren and Carl Caleman and Geoffrey R. Hutchison and David van der Spoel Polarizable Drude Model with s-type Gaussian or Slater Charge Density for General Molecular Mechanics Force Fields, J. Chem. Theory Comput. 14, 5553-5566 (2018). DOI
|