|
|
Summary
longprop
| IUPAC name | ethyl naphthalene-1-carboxylate | | | | Synonyms | 3007-97-4, InChI=1S/C13H12O2/c1-2-15-13(14)12-9-5-7-10-6-3-4-8-11(10)12/h3-9H,2H2,1H3, alpha-naphthoic acid ethyl ester, ethyl 1-naphthoate, ethyl-naphthalene-1-carboxylate, ethyl-naphthalene-1-carboxylat | | CAS number | 3007-97-4 | | ChemSpider ID | 68841 | | PubChem ID | 76364 | | Molecular weight | 200.233 Da | | Formula | C13H12O2 | | Multiplicity | 1 | | Point group | C1 | | Symmetry number | 1 | | Rotatable bonds | 3 | | StdInChi | InChI=1S/C13H12O2/c1-2-15-13(14)12-9-5-7-10-6-3-4-8-11(10)12/h3-9H,2H2,1H3 |
Liquid properties
| Property | Unit | T (K) | Experiment | GAFF-ESP-2012 | OPLS | CGenFF | COSMO-RS | kowwin | GAFF-ESP | XlogP3 |
|---|
| log kOW | | 298.15 | | | | | | | | 3.801 | Flexible models Hydrogen constrained All bonds constrained.
Gas properties
| Property | Unit | T (K) | Experiment | G2 | G3 | G4 | CBS-QB3 | W1BD | W1U | B3LYP/aug-cc-pVTZ | BS | CGenFF | GAFF-BCC-2018 | GAFF-ESP-2018 | AXpp | AXpg | AXps |
|---|
| E | kJ/mol | 298.15 | | | | 605.972 | | | | | | | | | | | | | ΔHform | kJ/mol | 0 | | | -204.02 | -200.82 | -199.62 | | | | | | | | | | | | ΔHform | kJ/mol | 298.15 | | | -243.42 | -238.02 | -236.82 | | | | | | | | | | | | ΔGform | kJ/mol | 298.15 | | | -64.92 | -64.42 | -63.12 | | | | | | | | | | | | ΔSform | J/mol K | 298.15 | | | -598.62 | -582.32 | -582.52 | | | | | | | | | | | | S0 | J/mol K | 298.15 | | | 465.292 | 481.532 | 481.302 | | | | | | | | | | | | ZPE | kJ/mol | 298.15 | | | | 572.52 | | | | | | | | | | | | | CV | J/mol K | 298.15 | | | 189.32 | 205.52 | 205.52 | | | | | | | | | | |
References
- T. Cheng and Y. Zhao and X. Li and F. Lin and Y. Xu and X. Zhang and Y. Li and R. Wang and L. Lai Computation of octanol- water partition coefficients by guiding an additive model with knowledge., J. Chem. Inf. Model. 47, 2140-2148 (2007).
- Mohammad M. Ghahremanpour and Paul J. van Maaren and David van der Spoel The Alexandria Library: A Quantum-Chemical Database of Molecular Properties for Force Field Development, Sci. Data 5, 180062 (2018). DOI
|