|
|
Summary
longprop
| IUPAC name | (3Z)-2-methylhept-3-ene | | | | Synonyms | 692-96-6, InChI=1S/C8H16/c1-4-5-6-7-8(2)3/h6-8H,4-5H2,1-3H3/b7-6-, 2-methyl-trans-3-heptene, (3Z)-2-methyl-3-heptene, 3Z-2-methylhept-3-ene, 3Z-2-methylhept-3-en | | CAS number | 692-96-6 | | ChemSpider ID | 4936249 | | ChemSpider ID | NA | | Molecular weight | 112.2126 Da | | Formula | C8H16 | | Multiplicity | 1 | | Point group | C1 | | Symmetry number | 1 | | Rotatable bonds | 3 | | StdInChi | InChI=1S/C8H16/c1-4-5-6-7-8(2)3/h6-8H,4-5H2,1-3H3/b7-6- |
Liquid properties
| Property | Unit | T (K) | Experiment | GAFF-ESP-2012 | OPLS | CGenFF | COSMO-RS | kowwin | GAFF-ESP | XlogP3 |
|---|
Flexible models Hydrogen constrained All bonds constrained.
Gas properties
| Property | Unit | T (K) | Experiment | G2 | G3 | G4 | CBS-QB3 | W1BD | W1U | B3LYP/aug-cc-pVTZ | BS | CGenFF | GAFF-BCC-2018 | GAFF-ESP-2018 | AXpp | AXpg | AXps |
|---|
| E | kJ/mol | 298.15 | | | | 610.481 | | | | | | 588.852 | | | | | | | E-scaled | kJ/mol | 298.15 | | | | | | | | | | 607.752 | | | | | | | ΔHform | kJ/mol | 0 | | -30.11 | -34.01 | -30.81 | -20.51 | | | | | | | | | | | | ΔHform | kJ/mol | 298.15 | -84.53 | -78.11 | -82.01 | -77.21 | -66.91 | | | | | | | | | | | | ΔGform | kJ/mol | 298.15 | | 125.41 | 121.51 | 122.81 | 132.81 | | | | | | | | | | | | ΔSform | J/mol K | 298.15 | | -682.51 | -682.51 | -671.01 | -669.81 | | | | | | | | | | | | S0 | J/mol K | 298.15 | | 408.821 | 408.821 | 420.411 | 421.601 | | | | | 412.982 | | | | | | | S0-scaled | J/mol K | 298.15 | | | | | | | | | | 408.212 | | | | | | | ZPE | kJ/mol | 298.15 | | | | 583.31 | | | | | | 561.02 | | | | | | | ZPE-scaled | kJ/mol | 298.15 | | | | | | | | | | 580.62 | | | | | | | CV | J/mol K | 298.15 | | 146.31 | 146.31 | 157.81 | 157.91 | | | | | 166.22 | | | | | | | CV-scaled | J/mol K | 298.15 | | | | | | | | | | 161.22 | | | | | | | αaniso | ų | 298.15 | | | | | | | | | | | | | 3.364 | 3.364 | 3.354 | | αxx | ų | 298.15 | | | | | | | | 18.771 | | | | | 17.994 | 17.994 | 17.984 | | αyy | ų | 298.15 | | | | | | | | 14.101 | | | | | 14.934 | 14.934 | 14.934 | | αzz | ų | 298.15 | | | | | | | | 13.131 | | | | | 14.424 | 14.414 | 14.414 | | μxx | D | 298.15 | | | | | | | | -0.231 | | | | | -0.234 | -0.234 | -0.234 | | μyy | D | 298.15 | | | | | | | | 0.261 | | | | | 0.274 | 0.264 | 0.274 | | μzz | D | 298.15 | | | | | | | | 0.091 | | | | | 0.094 | 0.114 | 0.114 | | θxx | Buckingham | 298.15 | | | | | | | | 1.541 | | | | | 2.044 | 2.234 | 2.284 | | θyy | Buckingham | 298.15 | | | | | | | | 0.021 | | | | | 0.034 | -0.104 | -0.104 | | θzz | Buckingham | 298.15 | | | | | | | | -1.431 | | | | | -2.074 | -2.134 | -2.184 |
References
- Mohammad M. Ghahremanpour and Paul J. van Maaren and David van der Spoel The Alexandria Library: A Quantum-Chemical Database of Molecular Properties for Force Field Development, Sci. Data 5, 180062 (2018). DOI
- David van der Spoel and Mohammad M. Ghahremanpour and Justin Lemkul Small Molecule Thermochemistry: A Tool For Empirical Force Field Development, J. Phys. Chem. A 122, 8982–8988 (2018). DOI
- C. L. Yaws Yaws' Handbook of Thermodynamic Properties for Hydrocarbons and Chemicals, Knovel (2009).
- Mohammad Mehdi Ghahremanpour and Paul J. van Maaren and Carl Caleman and Geoffrey R. Hutchison and David van der Spoel Polarizable Drude Model with s-type Gaussian or Slater Charge Density for General Molecular Mechanics Force Fields, J. Chem. Theory Comput. 14, 5553-5566 (2018). DOI
|