|
|
Summary
longprop
| IUPAC name | 1,2,3,4,5-pentafluorobenzene | | | | Synonyms | 363-72-4, InChI=1S/C6HF5/c7-2-1-3(8)5(10)6(11)4(2)9/h1H, pentafluorobenzene, 12345-pentafluorobenzene, 12345-pentafluorobenzen | | CAS number | 363-72-4 | | ChemSpider ID | 13866746 | | PubChem ID | 9696 | | Molecular weight | 168.064 Da | | Formula | C6HF5 | | Multiplicity | 1 | | Point group | Cs | | Symmetry number | 1 | | Rotatable bonds | NA | | StdInChi | InChI=1S/C6HF5/c7-2-1-3(8)5(10)6(11)4(2)9/h1H |
Liquid properties
| Property | Unit | T (K) | Experiment | GAFF-ESP-2012 | OPLS | CGenFF | COSMO-RS | kowwin | GAFF-ESP | XlogP3 |
|---|
| log kOW | | 298.15 | 2.531 | | | | 3.252 | | | 2.503 | | log kHW | | 298.15 | | | | | 3.132 | | | | Flexible models Hydrogen constrained All bonds constrained.
Gas properties
| Property | Unit | T (K) | Experiment | G2 | G3 | G4 | CBS-QB3 | W1BD | W1U | B3LYP/aug-cc-pVTZ | BS | CGenFF | GAFF-BCC-2018 | GAFF-ESP-2018 | AXpp | AXpg | AXps |
|---|
| E | kJ/mol | 298.15 | | | | 179.494 | | | | | | 174.405 | | | | | | | E-scaled | kJ/mol | 298.15 | | | | | | | | | | 179.095 | | | | | | | ΔHform | kJ/mol | 0 | | -818.14 | -812.74 | -795.84 | -824.44 | | | | | | | | | | | | ΔHform | kJ/mol | 298.15 | -806.26 | -827.04 | -821.64 | -803.24 | -831.84 | | | | | | | | | | | | | | -806.57 | | | | | | | | | | | | | | | | | | -806.0±1.48 | | | | | | | | | | | | | | | | ΔGform | kJ/mol | 298.15 | | -757.34 | -751.94 | -736.54 | -765.14 | | | | | | | | | | | | ΔSform | J/mol K | 298.15 | | -233.74 | -233.74 | -223.94 | -223.84 | | | | | | | | | | | | S0 | J/mol K | 298.15 | | 373.034 | 373.034 | 382.884 | 382.964 | | | | | 382.845 | | | | | | | S0-scaled | J/mol K | 298.15 | | | | | | | | | | 379.055 | | | | | | | ZPE | kJ/mol | 298.15 | | | | 156.74 | | | | | | 151.55 | | | | | | | ZPE-scaled | kJ/mol | 298.15 | | | | | | | | | | 156.85 | | | | | | | CV | J/mol K | 298.15 | 134.7±2.79 | 126.34 | 126.34 | 134.24 | 134.24 | | | | | 136.75 | | | | | | | CV-scaled | J/mol K | 298.15 | | | | | | | | | | 133.55 | | | | | | | αaniso | ų | 298.15 | | | | | | | | | | | | | 1.7410 | 1.7310 | 1.7310 |
References
- C. Hansch and A. Leo and D. Hoekman Exploring QSAR - Hydrophobic, Electronic, and Steric Constants, American Chemical Society (1995).
- David van der Spoel and Sergio Manzetti and Haiyang Zhang and Andreas Klamt Prediction of partition coefficients of environmental toxins using computational chemistry methods, ACS Omega (2019).
- T. Cheng and Y. Zhao and X. Li and F. Lin and Y. Xu and X. Zhang and Y. Li and R. Wang and L. Lai Computation of octanol- water partition coefficients by guiding an additive model with knowledge., J. Chem. Inf. Model. 47, 2140-2148 (2007).
- Mohammad M. Ghahremanpour and Paul J. van Maaren and David van der Spoel The Alexandria Library: A Quantum-Chemical Database of Molecular Properties for Force Field Development, Sci. Data 5, 180062 (2018). DOI
- David van der Spoel and Mohammad M. Ghahremanpour and Justin Lemkul Small Molecule Thermochemistry: A Tool For Empirical Force Field Development, J. Phys. Chem. A 122, 8982–8988 (2018). DOI
- C. L. Yaws Yaws' Handbook of Thermodynamic Properties for Hydrocarbons and Chemicals, Knovel (2009).
- D. R. Lide CRC Handbook of Chemistry and Physics 90th edition, CRC Press: Cleveland, Ohio (2009).
- Knovel Knovel Critical Tables (2nd Edition), Knovel (2008).
- Mohammad M. Ghahremanpour and Paul J. van Maaren and Jonas C. Ditz and Roland Lindh and David van der Spoel Large-Scale Calculations of Gas Phase Thermochemistry: Enthalpy of Formation, Standard Entropy and Heat Capacity, J. Chem. Phys. 145, 114305 (2016). DOI
- Mohammad Mehdi Ghahremanpour and Paul J. van Maaren and Carl Caleman and Geoffrey R. Hutchison and David van der Spoel Polarizable Drude Model with s-type Gaussian or Slater Charge Density for General Molecular Mechanics Force Fields, J. Chem. Theory Comput. 14, 5553-5566 (2018). DOI
|