|
|
Summary
longprop
| IUPAC name | 1,1-difluorocyclohexane | | | | Synonyms | 371-90-4, InChI=1S/C6H10F2/c7-6(8)4-2-1-3-5-6/h1-5H2, 11-difluorocyclohexane, 11-difluorocyclohexan | | CAS number | 371-90-4 | | ChemSpider ID | 144283 | | PubChem ID | 164586 | | Molecular weight | 120.14 Da | | Formula | C6H10F2 | | Multiplicity | 1 | | Point group | C1 | | Symmetry number | 1 | | Rotatable bonds | NA | | StdInChi | InChI=1S/C6H10F2/c7-6(8)4-2-1-3-5-6/h1-5H2 |
Liquid properties
| Property | Unit | T (K) | Experiment | GAFF-ESP-2012 | OPLS | CGenFF | COSMO-RS | kowwin | GAFF-ESP | XlogP3 |
|---|
| log kOW | | 298.15 | | | | | | | | 2.601 | Flexible models Hydrogen constrained All bonds constrained.
Gas properties
| Property | Unit | T (K) | Experiment | G2 | G3 | G4 | CBS-QB3 | W1BD | W1U | B3LYP/aug-cc-pVTZ | BS | CGenFF | GAFF-BCC-2018 | GAFF-ESP-2018 | AXpp | AXpg | AXps |
|---|
| E | kJ/mol | 298.15 | | | | 423.322 | | | | | | 408.693 | | | | | | | E-scaled | kJ/mol | 298.15 | | | | | | | | | | 421.763 | | | | | | | ΔHform | kJ/mol | 0 | | -549.22 | -544.82 | -535.72 | -542.72 | | | | | | | | | | | | ΔHform | kJ/mol | 298.15 | | -586.82 | -582.32 | -571.92 | -578.92 | | | | | | | | | | | | ΔGform | kJ/mol | 298.15 | | -422.02 | -417.52 | -409.32 | -416.42 | | | | | | | | | | | | ΔSform | J/mol K | 298.15 | | -552.82 | -552.82 | -545.42 | -545.22 | | | | | | | | | | | | S0 | J/mol K | 298.15 | | 337.782 | 337.782 | 345.222 | 345.452 | | | | | 343.983 | | | | | | | S0-scaled | J/mol K | 298.15 | | | | | | | | | | 340.753 | | | | | | | ZPE | kJ/mol | 298.15 | | | | 404.62 | | | | | | 390.03 | | | | | | | ZPE-scaled | kJ/mol | 298.15 | | | | | | | | | | 403.73 | | | | | | | CV | J/mol K | 298.15 | | 108.32 | 108.32 | 118.62 | 118.82 | | | | | 121.03 | | | | | | | CV-scaled | J/mol K | 298.15 | | | | | | | | | | 116.53 | | | | | | | αaniso | ų | 298.15 | | | | | | | | | | | | | 1.684 | 1.694 | 1.684 | | αxx | ų | 298.15 | | | | | | | | 9.802 | | | | | 10.314 | 10.314 | 10.304 | | αyy | ų | 298.15 | | | | | | | | 11.222 | | | | | 11.734 | 11.744 | 11.734 | | αzz | ų | 298.15 | | | | | | | | 10.942 | | | | | 11.834 | 11.844 | 11.834 | | μxx | D | 298.15 | | | | | | | | 1.812 | | | | | 1.814 | 1.804 | 1.804 | | μyy | D | 298.15 | | | | | | | | -2.062 | | | | | -2.054 | -2.054 | -2.044 | | μzz | D | 298.15 | | | | | | | | 2 | | | | | 4 | 4 | 4 | | θxx | Buckingham | 298.15 | | | | | | | | -0.832 | | | | | -1.274 | -1.304 | -1.304 | | θyy | Buckingham | 298.15 | | | | | | | | -2.622 | | | | | -4.374 | -4.324 | -4.314 | | θzz | Buckingham | 298.15 | | | | | | | | 3.752 | | | | | 5.644 | 5.624 | 5.614 |
References
- T. Cheng and Y. Zhao and X. Li and F. Lin and Y. Xu and X. Zhang and Y. Li and R. Wang and L. Lai Computation of octanol- water partition coefficients by guiding an additive model with knowledge., J. Chem. Inf. Model. 47, 2140-2148 (2007).
- Mohammad M. Ghahremanpour and Paul J. van Maaren and David van der Spoel The Alexandria Library: A Quantum-Chemical Database of Molecular Properties for Force Field Development, Sci. Data 5, 180062 (2018). DOI
- David van der Spoel and Mohammad M. Ghahremanpour and Justin Lemkul Small Molecule Thermochemistry: A Tool For Empirical Force Field Development, J. Phys. Chem. A 122, 8982–8988 (2018). DOI
- Mohammad Mehdi Ghahremanpour and Paul J. van Maaren and Carl Caleman and Geoffrey R. Hutchison and David van der Spoel Polarizable Drude Model with s-type Gaussian or Slater Charge Density for General Molecular Mechanics Force Fields, J. Chem. Theory Comput. 14, 5553-5566 (2018). DOI
|