|
|
Summary
longprop
| IUPAC name | 1-Isopropoxy-2-propanol | | | | Synonyms | 223-533-2, InChI=1S/C6H14O2/c1-5(2)8-4-6(3)7/h5-7H,4H2,1-3H3, 1-(methylethoxy)propan-2-ol, 1-Isopropoxypropan-2-ol, 1-(1-methylethoxy)-2-propanol, 1-isopropoxy-2-propanol, 1-isopropoxy-2-propano | | CAS number | 223-533-2 | | ChemSpider ID | 18695 | | PubChem ID | 19846 | | Molecular weight | 118.174 Da | | Formula | C6H14O2 | | Multiplicity | 1 | | Point group | C1 | | Symmetry number | 1 | | Rotatable bonds | 3 | | StdInChi | InChI=1S/C6H14O2/c1-5(2)8-4-6(3)7/h5-7H,4H2,1-3H3 |
Liquid properties
| Property | Unit | T (K) | Experiment | GAFF-ESP-2012 | OPLS | CGenFF | COSMO-RS | kowwin | GAFF-ESP | XlogP3 |
|---|
| log kOW | | 298.15 | 0.831 | | | | | | | 0.402 | Flexible models Hydrogen constrained All bonds constrained.
Gas properties
| Property | Unit | T (K) | Experiment | G2 | G3 | G4 | CBS-QB3 | W1BD | W1U | B3LYP/aug-cc-pVTZ | BS | CGenFF | GAFF-BCC-2018 | GAFF-ESP-2018 | AXpp | AXpg | AXps |
|---|
| E | kJ/mol | 298.15 | | | | | | | | | | 530.123 | | | | | | | E-scaled | kJ/mol | 298.15 | | | | | | | | | | 547.043 | | | | | | | S0 | J/mol K | 298.15 | 480.194 | | | | | | | | | 417.473 | | | | | | | S0-scaled | J/mol K | 298.15 | | | | | | | | | | 412.933 | | | | | | | ZPE | kJ/mol | 298.15 | | | | 516.55 | | | | | | 502.53 | | | | | | | ZPE-scaled | kJ/mol | 298.15 | | | | | | | | | | 520.13 | | | | | | | CV | J/mol K | 298.15 | 161.9±3.26 | | | | | | | | | 159.13 | | | | | | | CV-scaled | J/mol K | 298.15 | | | | | | | | | | 154.63 | | | | | | | αaniso | ų | 298.15 | | | | | | | | | | | | | 2.467 | 2.467 | 2.457 | | αxx | ų | 298.15 | | | | | | | | 14.895 | | | | | 14.877 | 14.877 | 14.867 | | αyy | ų | 298.15 | | | | | | | | 12.335 | | | | | 12.477 | 12.477 | 12.477 | | αzz | ų | 298.15 | | | | | | | | 12.115 | | | | | 12.367 | 12.367 | 12.367 | | μxx | D | 298.15 | | | | | | | | 1.615 | | | | | 1.657 | 1.637 | 1.637 | | μyy | D | 298.15 | | | | | | | | -0.675 | | | | | -0.697 | -0.687 | -0.687 | | μzz | D | 298.15 | | | | | | | | -1.125 | | | | | -1.157 | -1.157 | -1.167 | | θxx | Buckingham | 298.15 | | | | | | | | -3.335 | | | | | -5.207 | -5.147 | -5.127 | | θyy | Buckingham | 298.15 | | | | | | | | 0.475 | | | | | 1.247 | 1.277 | 1.227 | | θzz | Buckingham | 298.15 | | | | | | | | 2.255 | | | | | 3.957 | 3.877 | 3.907 |
References
- C. L. Yaws Yaws' Handbook of Properties for Environmental and Green Engineering, William Andrew Inc.: Beaumont, Texas (2008).
- T. Cheng and Y. Zhao and X. Li and F. Lin and Y. Xu and X. Zhang and Y. Li and R. Wang and L. Lai Computation of octanol- water partition coefficients by guiding an additive model with knowledge., J. Chem. Inf. Model. 47, 2140-2148 (2007).
- David van der Spoel and Mohammad M. Ghahremanpour and Justin Lemkul Small Molecule Thermochemistry: A Tool For Empirical Force Field Development, J. Phys. Chem. A 122, 8982–8988 (2018). DOI
- C. L. Yaws Yaws' Handbook of Thermodynamic Properties for Hydrocarbons and Chemicals, Knovel (2009).
- Mohammad M. Ghahremanpour and Paul J. van Maaren and David van der Spoel The Alexandria Library: A Quantum-Chemical Database of Molecular Properties for Force Field Development, Sci. Data 5, 180062 (2018). DOI
- Mohammad M. Ghahremanpour and Paul J. van Maaren and Jonas C. Ditz and Roland Lindh and David van der Spoel Large-Scale Calculations of Gas Phase Thermochemistry: Enthalpy of Formation, Standard Entropy and Heat Capacity, J. Chem. Phys. 145, 114305 (2016). DOI
- Mohammad Mehdi Ghahremanpour and Paul J. van Maaren and Carl Caleman and Geoffrey R. Hutchison and David van der Spoel Polarizable Drude Model with s-type Gaussian or Slater Charge Density for General Molecular Mechanics Force Fields, J. Chem. Theory Comput. 14, 5553-5566 (2018). DOI
|